C22H25NO4 — CID 11394509
benzyl N-[(3S,4S,5S)-5-hydroxy-3-methyl-4-phenylmethoxyhex-1-yn-3-yl]carbamate (PubChem CID 11394509) has the molecular formula C22H25NO4 and a molecular weight of 367.44 g/mol. Its IUPAC name is benzyl N-[(3S,4S,5S)-5-hydroxy-3-methyl-4-phenylmethoxyhex-1-yn-3-yl]carbamate.
| Compound Name | benzyl N-[(3S,4S,5S)-5-hydroxy-3-methyl-4-phenylmethoxyhex-1-yn-3-yl]carbamate |
|---|---|
| PubChem CID | 11394509 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | benzyl N-[(3S,4S,5S)-5-hydroxy-3-methyl-4-phenylmethoxyhex-1-yn-3-yl]carbamate |
| SMILES | C#C[C@](C)(NC(=O)OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](C)O |
| InChI | InChI=1S/C22H25NO4/c1-4-22(3,23-21(25)27-16-19-13-9-6-10-14-19)20(17(2)24)26-15-18-11-7-5-8-12-18/h1,5-14,17,20,24H,15-16H2,2-3H3,(H,23,25)/t17-,20+,22-/m0/s1 |
| InChIKey | WSPZTGBIQFDDFW-WEYGHZABSA-N |
| XLogP | 3.27 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|