C17H20F4O5S — CID 11395816
ethyl (Z)-3-fluoro-4-(4-methylphenyl)sulfonyloxy-3-(trifluoromethyl)hept-4-enoate (PubChem CID 11395816) has the molecular formula C17H20F4O5S and a molecular weight of 412.40 g/mol. Its IUPAC name is ethyl (Z)-3-fluoro-4-(4-methylphenyl)sulfonyloxy-3-(trifluoromethyl)hept-4-enoate.
| Compound Name | ethyl (Z)-3-fluoro-4-(4-methylphenyl)sulfonyloxy-3-(trifluoromethyl)hept-4-enoate |
|---|---|
| PubChem CID | 11395816 |
| Molecular Formula | C17H20F4O5S |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | ethyl (Z)-3-fluoro-4-(4-methylphenyl)sulfonyloxy-3-(trifluoromethyl)hept-4-enoate |
| SMILES | CC/C=C(\OS(=O)(=O)c1ccc(C)cc1)C(F)(CC(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C17H20F4O5S/c1-4-6-14(16(18,17(19,20)21)11-15(22)25-5-2)26-27(23,24)13-9-7-12(3)8-10-13/h6-10H,4-5,11H2,1-3H3/b14-6- |
| InChIKey | QWHRSUWSCLRRGH-NSIKDUERSA-N |
| XLogP | 4.22 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|