C9H8F4N2O3 — CID 11402917
2,6-bis(difluoromethoxy)-N'-hydroxybenzenecarboximidamide (PubChem CID 11402917) has the molecular formula C9H8F4N2O3 and a molecular weight of 268.17 g/mol. Its IUPAC name is 2,6-bis(difluoromethoxy)-N'-hydroxybenzenecarboximidamide.
| Compound Name | 2,6-bis(difluoromethoxy)-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 11402917 |
| Molecular Formula | C9H8F4N2O3 |
| Molecular Weight | 268.17 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2,6-bis(difluoromethoxy)-N'-hydroxybenzenecarboximidamide |
| SMILES | N/C(=N\O)c1c(OC(F)F)cccc1OC(F)F |
| InChI | InChI=1S/C9H8F4N2O3/c10-8(11)17-4-2-1-3-5(18-9(12)13)6(4)7(14)15-16/h1-3,8-9,16H,(H2,14,15) |
| InChIKey | GKULLOATFFCITA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.17 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|