C13H23N3O — CID 114039693
1-methyl-4-[[3-(propan-2-ylamino)propylamino]methyl]pyridin-2-one (PubChem CID 114039693) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 1-methyl-4-[[3-(propan-2-ylamino)propylamino]methyl]pyridin-2-one.
| Compound Name | 1-methyl-4-[[3-(propan-2-ylamino)propylamino]methyl]pyridin-2-one |
|---|---|
| PubChem CID | 114039693 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 1-methyl-4-[[3-(propan-2-ylamino)propylamino]methyl]pyridin-2-one |
| SMILES | CC(C)NCCCNCc1ccn(C)c(=O)c1 |
| InChI | InChI=1S/C13H23N3O/c1-11(2)15-7-4-6-14-10-12-5-8-16(3)13(17)9-12/h5,8-9,11,14-15H,4,6-7,10H2,1-3H3 |
| InChIKey | KLIXIZKKKGNULZ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|