C21H28ClNO3 — CID 11406280
2-[(1R,5R,6R,8aS)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-(2-chloro-3-pyridinyl)ethanone (PubChem CID 11406280) has the molecular formula C21H28ClNO3 and a molecular weight of 377.91 g/mol. Its IUPAC name is 2-[(1R,5R,6R,8aS)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-(2-chloro-3-pyridinyl)ethanone.
| Compound Name | 2-[(1R,5R,6R,8aS)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-(2-chloro-3-pyridinyl)ethanone |
|---|---|
| PubChem CID | 11406280 |
| Molecular Formula | C21H28ClNO3 |
| Molecular Weight | 377.91 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 2-[(1R,5R,6R,8aS)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-(2-chloro-3-pyridinyl)ethanone |
| SMILES | C=C1CCC2[C@](C)(CO)[C@H](O)CC[C@@]2(C)[C@@H]1CC(=O)c1cccnc1Cl |
| InChI | InChI=1S/C21H28ClNO3/c1-13-6-7-17-20(2,9-8-18(26)21(17,3)12-24)15(13)11-16(25)14-5-4-10-23-19(14)22/h4-5,10,15,17-18,24,26H,1,6-9,11-12H2,2-3H3/t15-,17?,18-,20+,21+/m1/s1 |
| InChIKey | VNBCATDLMQNRQY-MLMFDRTISA-N |
| XLogP | 4.05 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.91 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|