C10H15BrN4O2 — CID 114072172
ethyl 3-[[5-bromo-6-(methylamino)pyrimidin-4-yl]amino]propanoate (PubChem CID 114072172) has the molecular formula C10H15BrN4O2 and a molecular weight of 303.16 g/mol. Its IUPAC name is ethyl 3-[[5-bromo-6-(methylamino)pyrimidin-4-yl]amino]propanoate.
| Compound Name | ethyl 3-[[5-bromo-6-(methylamino)pyrimidin-4-yl]amino]propanoate |
|---|---|
| PubChem CID | 114072172 |
| Molecular Formula | C10H15BrN4O2 |
| Molecular Weight | 303.16 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | ethyl 3-[[5-bromo-6-(methylamino)pyrimidin-4-yl]amino]propanoate |
| SMILES | CCOC(=O)CCNc1ncnc(NC)c1Br |
| InChI | InChI=1S/C10H15BrN4O2/c1-3-17-7(16)4-5-13-10-8(11)9(12-2)14-6-15-10/h6H,3-5H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | NNVSGGLWVKUITO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.16 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |