C13H19BrClN3 — CID 114087717
1-[5-bromo-3-(chloromethyl)-2-pyridinyl]-2,4-dimethyl-1,4-diazepane (PubChem CID 114087717) has the molecular formula C13H19BrClN3 and a molecular weight of 332.67 g/mol. Its IUPAC name is 1-[5-bromo-3-(chloromethyl)-2-pyridinyl]-2,4-dimethyl-1,4-diazepane.
| Compound Name | 1-[5-bromo-3-(chloromethyl)-2-pyridinyl]-2,4-dimethyl-1,4-diazepane |
|---|---|
| PubChem CID | 114087717 |
| Molecular Formula | C13H19BrClN3 |
| Molecular Weight | 332.67 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 1-[5-bromo-3-(chloromethyl)-2-pyridinyl]-2,4-dimethyl-1,4-diazepane |
| SMILES | CC1CN(C)CCCN1c1ncc(Br)cc1CCl |
| InChI | InChI=1S/C13H19BrClN3/c1-10-9-17(2)4-3-5-18(10)13-11(7-15)6-12(14)8-16-13/h6,8,10H,3-5,7,9H2,1-2H3 |
| InChIKey | AXPONUCFBYMUAG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.67 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|