C30H54O10Si — CID 11410867
methyl (2R,3S,4S,5R)-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-3,4,5-tris(2,2-dimethylpropanoyloxy)oxane-2-carboxylate (PubChem CID 11410867) has the molecular formula C30H54O10Si and a molecular weight of 602.84 g/mol. Its IUPAC name is methyl (2R,3S,4S,5R)-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-3,4,5-tris(2,2-dimethylpropanoyloxy)oxane-2-carboxylate.
| Compound Name | methyl (2R,3S,4S,5R)-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-3,4,5-tris(2,2-dimethylpropanoyloxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 11410867 |
| Molecular Formula | C30H54O10Si |
| Molecular Weight | 602.84 g/mol |
| Exact Mass | 602.35 |
| IUPAC Name | methyl (2R,3S,4S,5R)-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-3,4,5-tris(2,2-dimethylpropanoyloxy)oxane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1OC(O[Si](C)(C)C(C)(C)C(C)C)[C@H](OC(=O)C(C)(C)C)[C@@H](OC(=O)C(C)(C)C)[C@@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C30H54O10Si/c1-17(2)30(12,13)41(15,16)40-23-21(39-26(34)29(9,10)11)19(38-25(33)28(6,7)8)18(20(36-23)22(31)35-14)37-24(32)27(3,4)5/h17-21,23H,1-16H3/t18-,19-,20+,21+,23?/m0/s1 |
| InChIKey | NDHYUWIOXJZCFI-JZKMLYSCSA-N |
| XLogP | 5.42 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.84 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|