C9H11BrN4O2S2 — CID 114134489
2-bromo-5-(methylaminomethyl)-N-(1H-pyrazol-4-yl)thiophene-3-sulfonamide (PubChem CID 114134489) has the molecular formula C9H11BrN4O2S2 and a molecular weight of 351.25 g/mol. Its IUPAC name is 2-bromo-5-(methylaminomethyl)-N-(1H-pyrazol-4-yl)thiophene-3-sulfonamide.
| Compound Name | 2-bromo-5-(methylaminomethyl)-N-(1H-pyrazol-4-yl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 114134489 |
| Molecular Formula | C9H11BrN4O2S2 |
| Molecular Weight | 351.25 g/mol |
| Exact Mass | 349.95 |
| IUPAC Name | 2-bromo-5-(methylaminomethyl)-N-(1H-pyrazol-4-yl)thiophene-3-sulfonamide |
| SMILES | CNCc1cc(S(=O)(=O)Nc2cn[nH]c2)c(Br)s1 |
| InChI | InChI=1S/C9H11BrN4O2S2/c1-11-5-7-2-8(9(10)17-7)18(15,16)14-6-3-12-13-4-6/h2-4,11,14H,5H2,1H3,(H,12,13) |
| InChIKey | PJYPWCDTLGXUAN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |