C14H22ClN3O — CID 114149529
N-(5-chloro-2,2-dimethylpentyl)-3,6-dimethylpyridazine-4-carboxamide (PubChem CID 114149529) has the molecular formula C14H22ClN3O and a molecular weight of 283.80 g/mol. Its IUPAC name is N-(5-chloro-2,2-dimethylpentyl)-3,6-dimethylpyridazine-4-carboxamide.
| Compound Name | N-(5-chloro-2,2-dimethylpentyl)-3,6-dimethylpyridazine-4-carboxamide |
|---|---|
| PubChem CID | 114149529 |
| Molecular Formula | C14H22ClN3O |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | N-(5-chloro-2,2-dimethylpentyl)-3,6-dimethylpyridazine-4-carboxamide |
| SMILES | Cc1cc(C(=O)NCC(C)(C)CCCCl)c(C)nn1 |
| InChI | InChI=1S/C14H22ClN3O/c1-10-8-12(11(2)18-17-10)13(19)16-9-14(3,4)6-5-7-15/h8H,5-7,9H2,1-4H3,(H,16,19) |
| InChIKey | DERNZAXJUWLQDC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|