C32H50N2O — CID 11420200
(14E,27Z,29Z)-18,24-diazapentacyclo[16.14.1.13,22.01,21.02,24]tetratriaconta-3(34),14,27,29-tetraen-31-ol (PubChem CID 11420200) has the molecular formula C32H50N2O and a molecular weight of 478.77 g/mol. Its IUPAC name is (14E,27Z,29Z)-18,24-diazapentacyclo[16.14.1.13,22.01,21.02,24]tetratriaconta-3(34),14,27,29-tetraen-31-ol.
| Compound Name | (14E,27Z,29Z)-18,24-diazapentacyclo[16.14.1.13,22.01,21.02,24]tetratriaconta-3(34),14,27,29-tetraen-31-ol |
|---|---|
| PubChem CID | 11420200 |
| Molecular Formula | C32H50N2O |
| Molecular Weight | 478.77 g/mol |
| Exact Mass | 478.39 |
| IUPAC Name | (14E,27Z,29Z)-18,24-diazapentacyclo[16.14.1.13,22.01,21.02,24]tetratriaconta-3(34),14,27,29-tetraen-31-ol |
| SMILES | OC1/C=C\C=C/CCN2CC3C=C4CCCCCCCCCC/C=C/CCN5CCC3C(C1)(C5)C42 |
| InChI | InChI=1S/C32H50N2O/c35-29-18-14-10-12-16-21-34-25-28-23-27-17-13-9-7-5-3-1-2-4-6-8-11-15-20-33-22-19-30(28)32(24-29,26-33)31(27)34/h8,10-12,14,18,23,28-31,35H,1-7,9,13,15-17,19-22,24-26H2/b11-8+,12-10-,18-14- |
| InChIKey | WBCLIGFNMAKNES-HYPVEDSNSA-N |
| XLogP | 6.66 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.77 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|