C13H19ClN4S — CID 114203396
N-(2-chloro-3-ethylpentyl)-3-methyl-[1,2]thiazolo[5,4-d]pyrimidin-4-amine (PubChem CID 114203396) has the molecular formula C13H19ClN4S and a molecular weight of 298.84 g/mol. Its IUPAC name is N-(2-chloro-3-ethylpentyl)-3-methyl-[1,2]thiazolo[5,4-d]pyrimidin-4-amine.
| Compound Name | N-(2-chloro-3-ethylpentyl)-3-methyl-[1,2]thiazolo[5,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 114203396 |
| Molecular Formula | C13H19ClN4S |
| Molecular Weight | 298.84 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | N-(2-chloro-3-ethylpentyl)-3-methyl-[1,2]thiazolo[5,4-d]pyrimidin-4-amine |
| SMILES | CCC(CC)C(Cl)CNc1ncnc2snc(C)c12 |
| InChI | InChI=1S/C13H19ClN4S/c1-4-9(5-2)10(14)6-15-12-11-8(3)18-19-13(11)17-7-16-12/h7,9-10H,4-6H2,1-3H3,(H,15,16,17) |
| InChIKey | AXOZXYSPQIOZME-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.84 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|