C13H24N2OS — CID 114227669
2-ethoxy-N'-[(3-ethylthiophen-2-yl)methyl]butane-1,4-diamine (PubChem CID 114227669) has the molecular formula C13H24N2OS and a molecular weight of 256.41 g/mol. Its IUPAC name is 2-ethoxy-N'-[(3-ethylthiophen-2-yl)methyl]butane-1,4-diamine.
| Compound Name | 2-ethoxy-N'-[(3-ethylthiophen-2-yl)methyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 114227669 |
| Molecular Formula | C13H24N2OS |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 2-ethoxy-N'-[(3-ethylthiophen-2-yl)methyl]butane-1,4-diamine |
| SMILES | CCOC(CN)CCNCc1sccc1CC |
| InChI | InChI=1S/C13H24N2OS/c1-3-11-6-8-17-13(11)10-15-7-5-12(9-14)16-4-2/h6,8,12,15H,3-5,7,9-10,14H2,1-2H3 |
| InChIKey | JOQCBQXHWIHGJP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|