About 2-ethoxy-N'-[(3-ethylthiophen-2-yl)methyl]butane-1,4-diamine
2-ethoxy-N'-[(3-ethylthiophen-2-yl)methyl]butane-1,4-diamine (PubChem CID 114227669) has the molecular formula C13H24N2OS
and a molecular weight of 256.41 g/mol. Its IUPAC name is 2-ethoxy-N'-[(3-ethylthiophen-2-yl)methyl]butane-1,4-diamine.
Molecular Properties
| Compound Name | 2-ethoxy-N'-[(3-ethylthiophen-2-yl)methyl]butane-1,4-diamine |
| PubChem CID | 114227669 |
| Molecular Formula | C13H24N2OS |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 2-ethoxy-N'-[(3-ethylthiophen-2-yl)methyl]butane-1,4-diamine |
| SMILES | CCOC(CN)CCNCc1sccc1CC |
| InChI | InChI=1S/C13H24N2OS/c1-3-11-6-8-17-13(11)10-15-7-5-12(9-14)16-4-2/h6,8,12,15H,3-5,7,9-10,14H2,1-2H3 |
| InChIKey | JOQCBQXHWIHGJP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-N'-[(3-ethylthiophen-2-yl)methyl]butane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-N'-[(3-ethylthiophen-2-yl)methyl]butane-1,4-diamine?
The IUPAC name of 2-ethoxy-N'-[(3-ethylthiophen-2-yl)methyl]butane-1,4-diamine (CID 114227669) is 2-ethoxy-N'-[(3-ethylthiophen-2-yl)methyl]butane-1,4-diamine.
What is the SMILES notation for 2-ethoxy-N'-[(3-ethylthiophen-2-yl)methyl]butane-1,4-diamine?
The canonical SMILES for 2-ethoxy-N'-[(3-ethylthiophen-2-yl)methyl]butane-1,4-diamine is CCOC(CN)CCNCc1sccc1CC.
What is the InChIKey of 2-ethoxy-N'-[(3-ethylthiophen-2-yl)methyl]butane-1,4-diamine?
The InChIKey is JOQCBQXHWIHGJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2OS/c1-3-11-6-8-17-13(11)10-15-7-5-12(9-14)16-4-2/h6,8,12,15H,3-5,7,9-10,14H2,1-2H3.
What are the key properties of 2-ethoxy-N'-[(3-ethylthiophen-2-yl)methyl]butane-1,4-diamine?
2-ethoxy-N'-[(3-ethylthiophen-2-yl)methyl]butane-1,4-diamine has a molecular weight of 256.41 g/mol, XLogP of 2.15, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-N'-[(3-ethylthiophen-2-yl)methyl]butane-1,4-diamine is sourced from PubChem (CID 114227669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).