C11H24N2O3S — CID 114232817
2-[4-(ethylamino)pentan-2-ylsulfonyl]-N,N-dimethylacetamide (PubChem CID 114232817) has the molecular formula C11H24N2O3S and a molecular weight of 264.39 g/mol. Its IUPAC name is 2-[4-(ethylamino)pentan-2-ylsulfonyl]-N,N-dimethylacetamide.
| Compound Name | 2-[4-(ethylamino)pentan-2-ylsulfonyl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 114232817 |
| Molecular Formula | C11H24N2O3S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 2-[4-(ethylamino)pentan-2-ylsulfonyl]-N,N-dimethylacetamide |
| SMILES | CCNC(C)CC(C)S(=O)(=O)CC(=O)N(C)C |
| InChI | InChI=1S/C11H24N2O3S/c1-6-12-9(2)7-10(3)17(15,16)8-11(14)13(4)5/h9-10,12H,6-8H2,1-5H3 |
| InChIKey | AGYMMTNMGOITLE-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |