C11H16N2O3S — CID 114240450
1-(3-amino-2,4-dimethylphenyl)sulfonylazetidin-3-ol (PubChem CID 114240450) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is 1-(3-amino-2,4-dimethylphenyl)sulfonylazetidin-3-ol.
| Compound Name | 1-(3-amino-2,4-dimethylphenyl)sulfonylazetidin-3-ol |
|---|---|
| PubChem CID | 114240450 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 1-(3-amino-2,4-dimethylphenyl)sulfonylazetidin-3-ol |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(O)C2)c(C)c1N |
| InChI | InChI=1S/C11H16N2O3S/c1-7-3-4-10(8(2)11(7)12)17(15,16)13-5-9(14)6-13/h3-4,9,14H,5-6,12H2,1-2H3 |
| InChIKey | KAQWZEHGWVBZGL-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|