C10H15N3O5 — CID 114243378
N-[2-(2-hydroxyethoxy)ethyl]-N-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide (PubChem CID 114243378) has the molecular formula C10H15N3O5 and a molecular weight of 257.25 g/mol. Its IUPAC name is N-[2-(2-hydroxyethoxy)ethyl]-N-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N-[2-(2-hydroxyethoxy)ethyl]-N-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 114243378 |
| Molecular Formula | C10H15N3O5 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | N-[2-(2-hydroxyethoxy)ethyl]-N-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide |
| SMILES | CN(CCOCCO)C(=O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H15N3O5/c1-13(2-4-18-5-3-14)9(16)7-6-11-10(17)12-8(7)15/h6,14H,2-5H2,1H3,(H2,11,12,15,17) |
| InChIKey | XCIFUOLUCAGSRX-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 115.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|