C11H10F3IN2 — CID 114257344
3,3,3-trifluoro-2-[(3-iodo-2-methylanilino)methyl]propanenitrile (PubChem CID 114257344) has the molecular formula C11H10F3IN2 and a molecular weight of 354.11 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(3-iodo-2-methylanilino)methyl]propanenitrile.
| Compound Name | 3,3,3-trifluoro-2-[(3-iodo-2-methylanilino)methyl]propanenitrile |
|---|---|
| PubChem CID | 114257344 |
| Molecular Formula | C11H10F3IN2 |
| Molecular Weight | 354.11 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | 3,3,3-trifluoro-2-[(3-iodo-2-methylanilino)methyl]propanenitrile |
| SMILES | Cc1c(I)cccc1NCC(C#N)C(F)(F)F |
| InChI | InChI=1S/C11H10F3IN2/c1-7-9(15)3-2-4-10(7)17-6-8(5-16)11(12,13)14/h2-4,8,17H,6H2,1H3 |
| InChIKey | GIQOEUWPBFLMHL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.11 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|