C11H16ClN3O2S2 — CID 114268365
2-chloro-N-(4-methylsulfanylbutyl)-5,5-dioxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine (PubChem CID 114268365) has the molecular formula C11H16ClN3O2S2 and a molecular weight of 321.86 g/mol. Its IUPAC name is 2-chloro-N-(4-methylsulfanylbutyl)-5,5-dioxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine.
| Compound Name | 2-chloro-N-(4-methylsulfanylbutyl)-5,5-dioxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 114268365 |
| Molecular Formula | C11H16ClN3O2S2 |
| Molecular Weight | 321.86 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 2-chloro-N-(4-methylsulfanylbutyl)-5,5-dioxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine |
| SMILES | CSCCCCNc1nc(Cl)nc2c1S(=O)(=O)CC2 |
| InChI | InChI=1S/C11H16ClN3O2S2/c1-18-6-3-2-5-13-10-9-8(14-11(12)15-10)4-7-19(9,16)17/h2-7H2,1H3,(H,13,14,15) |
| InChIKey | LIVBSUOCKQJIDQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.86 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|