C11H18N2O5S — CID 114277066
4-[2,2-dimethylpropyl(methoxy)sulfamoyl]-1H-pyrrole-2-carboxylic acid (PubChem CID 114277066) has the molecular formula C11H18N2O5S and a molecular weight of 290.34 g/mol. Its IUPAC name is 4-[2,2-dimethylpropyl(methoxy)sulfamoyl]-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-[2,2-dimethylpropyl(methoxy)sulfamoyl]-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 114277066 |
| Molecular Formula | C11H18N2O5S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 4-[2,2-dimethylpropyl(methoxy)sulfamoyl]-1H-pyrrole-2-carboxylic acid |
| SMILES | CON(CC(C)(C)C)S(=O)(=O)c1c[nH]c(C(=O)O)c1 |
| InChI | InChI=1S/C11H18N2O5S/c1-11(2,3)7-13(18-4)19(16,17)8-5-9(10(14)15)12-6-8/h5-6,12H,7H2,1-4H3,(H,14,15) |
| InChIKey | ZYYWUIILZBTCHG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 99.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|