C12H16FNO2S2 — CID 114285155
N-(2-fluoro-5-methylsulfonylphenyl)-4-methylthiolan-3-amine (PubChem CID 114285155) has the molecular formula C12H16FNO2S2 and a molecular weight of 289.40 g/mol. Its IUPAC name is N-(2-fluoro-5-methylsulfonylphenyl)-4-methylthiolan-3-amine.
| Compound Name | N-(2-fluoro-5-methylsulfonylphenyl)-4-methylthiolan-3-amine |
|---|---|
| PubChem CID | 114285155 |
| Molecular Formula | C12H16FNO2S2 |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | N-(2-fluoro-5-methylsulfonylphenyl)-4-methylthiolan-3-amine |
| SMILES | CC1CSCC1Nc1cc(S(C)(=O)=O)ccc1F |
| InChI | InChI=1S/C12H16FNO2S2/c1-8-6-17-7-12(8)14-11-5-9(18(2,15)16)3-4-10(11)13/h3-5,8,12,14H,6-7H2,1-2H3 |
| InChIKey | DNDAPAFOFIORGQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |