C13H24N2O3S — CID 114286773
4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-1,1-dioxothiolan-3-ol (PubChem CID 114286773) has the molecular formula C13H24N2O3S and a molecular weight of 288.41 g/mol. Its IUPAC name is 4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-1,1-dioxothiolan-3-ol.
| Compound Name | 4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 114286773 |
| Molecular Formula | C13H24N2O3S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-1,1-dioxothiolan-3-ol |
| SMILES | CN1CCCC2CN(C3CS(=O)(=O)CC3O)CCC21 |
| InChI | InChI=1S/C13H24N2O3S/c1-14-5-2-3-10-7-15(6-4-11(10)14)12-8-19(17,18)9-13(12)16/h10-13,16H,2-9H2,1H3 |
| InChIKey | PPRAYTPSAJZMIL-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |