C27H34O3Si — CID 11430470
(1R,2S,4R,5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-ethenyl-3,3-dimethyl-7-oxabicyclo[2.2.1]heptane-1-carbaldehyde (PubChem CID 11430470) has the molecular formula C27H34O3Si and a molecular weight of 434.65 g/mol. Its IUPAC name is (1R,2S,4R,5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-ethenyl-3,3-dimethyl-7-oxabicyclo[2.2.1]heptane-1-carbaldehyde.
| Compound Name | (1R,2S,4R,5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-ethenyl-3,3-dimethyl-7-oxabicyclo[2.2.1]heptane-1-carbaldehyde |
|---|---|
| PubChem CID | 11430470 |
| Molecular Formula | C27H34O3Si |
| Molecular Weight | 434.65 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | (1R,2S,4R,5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-ethenyl-3,3-dimethyl-7-oxabicyclo[2.2.1]heptane-1-carbaldehyde |
| SMILES | C=C[C@H]1C(C)(C)[C@H]2O[C@]1(C=O)C[C@@H]2O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H34O3Si/c1-7-23-26(5,6)24-22(18-27(23,19-28)29-24)30-31(25(2,3)4,20-14-10-8-11-15-20)21-16-12-9-13-17-21/h7-17,19,22-24H,1,18H2,2-6H3/t22-,23-,24-,27-/m0/s1 |
| InChIKey | QLLGFSYXKCMJTG-TTZMFTMZSA-N |
| XLogP | 4.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.65 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|