C23H37N9O15P2 — CID 11434567
[[[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] 5-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]-5-oxopentanoate (PubChem CID 11434567) has the molecular formula C23H37N9O15P2 and a molecular weight of 741.54 g/mol. Its IUPAC name is [[[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] 5-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]-5-oxopentanoate.
| Compound Name | [[[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] 5-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 11434567 |
| Molecular Formula | C23H37N9O15P2 |
| Molecular Weight | 741.54 g/mol |
| Exact Mass | 741.19 |
| IUPAC Name | [[[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] 5-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]-5-oxopentanoate |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCNC(=O)CCCC(=O)OP(=O)(O)OP(=O)(O)OCC1OC(n2cnc3c(N)ncnc32)C(O)C1O |
| InChI | InChI=1S/C23H37N9O15P2/c24-21-18-22(28-13-27-21)32(14-29-18)23-20(36)19(35)15(45-23)12-44-48(37,38)47-49(39,40)46-17(34)3-1-2-16(33)26-4-6-41-8-10-43-11-9-42-7-5-30-31-25/h13-15,19-20,23,35-36H,1-12H2,(H,26,33)(H,37,38)(H,39,40)(H2,24,27,28) |
| InChIKey | JQPXAJFWMDMUON-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 344.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.54 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|