C12H11Br2NO — CID 114377426
(5,7-dibromo-3-cyclopropyl-1-benzofuran-2-yl)methanamine (PubChem CID 114377426) has the molecular formula C12H11Br2NO and a molecular weight of 345.03 g/mol. Its IUPAC name is (5,7-dibromo-3-cyclopropyl-1-benzofuran-2-yl)methanamine.
| Compound Name | (5,7-dibromo-3-cyclopropyl-1-benzofuran-2-yl)methanamine |
|---|---|
| PubChem CID | 114377426 |
| Molecular Formula | C12H11Br2NO |
| Molecular Weight | 345.03 g/mol |
| Exact Mass | 342.92 |
| IUPAC Name | (5,7-dibromo-3-cyclopropyl-1-benzofuran-2-yl)methanamine |
| SMILES | NCc1oc2c(Br)cc(Br)cc2c1C1CC1 |
| InChI | InChI=1S/C12H11Br2NO/c13-7-3-8-11(6-1-2-6)10(5-15)16-12(8)9(14)4-7/h3-4,6H,1-2,5,15H2 |
| InChIKey | SFNHCOSZRJKILH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.03 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |