C7H9ClF2N2O2S2 — CID 114384052
N-(3-amino-2,2-difluoropropyl)-5-chlorothiophene-2-sulfonamide (PubChem CID 114384052) has the molecular formula C7H9ClF2N2O2S2 and a molecular weight of 290.74 g/mol. Its IUPAC name is N-(3-amino-2,2-difluoropropyl)-5-chlorothiophene-2-sulfonamide.
| Compound Name | N-(3-amino-2,2-difluoropropyl)-5-chlorothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 114384052 |
| Molecular Formula | C7H9ClF2N2O2S2 |
| Molecular Weight | 290.74 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | N-(3-amino-2,2-difluoropropyl)-5-chlorothiophene-2-sulfonamide |
| SMILES | NCC(F)(F)CNS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C7H9ClF2N2O2S2/c8-5-1-2-6(15-5)16(13,14)12-4-7(9,10)3-11/h1-2,12H,3-4,11H2 |
| InChIKey | BWQPTPMOHRQUIB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.74 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |