C12H16N4O5S — CID 11438862
7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-dimethyl-6-sulfanylidenepurin-2-one (PubChem CID 11438862) has the molecular formula C12H16N4O5S and a molecular weight of 328.35 g/mol. Its IUPAC name is 7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-dimethyl-6-sulfanylidenepurin-2-one.
| Compound Name | 7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-dimethyl-6-sulfanylidenepurin-2-one |
|---|---|
| PubChem CID | 11438862 |
| Molecular Formula | C12H16N4O5S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-dimethyl-6-sulfanylidenepurin-2-one |
| SMILES | Cn1c(=S)c2c(ncn2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)n(C)c1=O |
| InChI | InChI=1S/C12H16N4O5S/c1-14-9-6(11(22)15(2)12(14)20)16(4-13-9)10-8(19)7(18)5(3-17)21-10/h4-5,7-8,10,17-19H,3H2,1-2H3/t5-,7-,8-,10-/m1/s1 |
| InChIKey | LIPJLYZNROSSKY-VPCXQMTMSA-N |
| XLogP | -1.59 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|