C16H23N5O6 — CID 163039997
6-amino-3-(3-methylbut-2-enyl)-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]purin-2-one (PubChem CID 163039997) has the molecular formula C16H23N5O6 and a molecular weight of 381.39 g/mol. Its IUPAC name is 6-amino-3-(3-methylbut-2-enyl)-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]purin-2-one.
| Compound Name | 6-amino-3-(3-methylbut-2-enyl)-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]purin-2-one |
|---|---|
| PubChem CID | 163039997 |
| Molecular Formula | C16H23N5O6 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 6-amino-3-(3-methylbut-2-enyl)-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]purin-2-one |
| SMILES | CC(C)=CCn1c(=O)nc(N)c2c1ncn2C1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C16H23N5O6/c1-7(2)3-4-20-14-9(13(17)19-16(20)26)21(6-18-14)15-12(25)11(24)10(23)8(5-22)27-15/h3,6,8,10-12,15,22-25H,4-5H2,1-2H3,(H2,17,19,26) |
| InChIKey | KPQOKZBKDUUWME-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 168.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|