C31H38N2O4SSi — CID 11444406
2-[1-(4-methylphenyl)sulfonyl-4-[4-methyl-5-tri(propan-2-yl)silyloxyfuran-2-yl]indol-3-yl]acetonitrile (PubChem CID 11444406) has the molecular formula C31H38N2O4SSi and a molecular weight of 562.81 g/mol. Its IUPAC name is 2-[1-(4-methylphenyl)sulfonyl-4-[4-methyl-5-tri(propan-2-yl)silyloxyfuran-2-yl]indol-3-yl]acetonitrile.
| Compound Name | 2-[1-(4-methylphenyl)sulfonyl-4-[4-methyl-5-tri(propan-2-yl)silyloxyfuran-2-yl]indol-3-yl]acetonitrile |
|---|---|
| PubChem CID | 11444406 |
| Molecular Formula | C31H38N2O4SSi |
| Molecular Weight | 562.81 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | 2-[1-(4-methylphenyl)sulfonyl-4-[4-methyl-5-tri(propan-2-yl)silyloxyfuran-2-yl]indol-3-yl]acetonitrile |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(CC#N)c3c(-c4cc(C)c(O[Si](C(C)C)(C(C)C)C(C)C)o4)cccc32)cc1 |
| InChI | InChI=1S/C31H38N2O4SSi/c1-20(2)39(21(3)4,22(5)6)37-31-24(8)18-29(36-31)27-10-9-11-28-30(27)25(16-17-32)19-33(28)38(34,35)26-14-12-23(7)13-15-26/h9-15,18-22H,16H2,1-8H3 |
| InChIKey | WSCCWFNEBZHUCS-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 85.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.81 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|