C30H52O8Si — CID 11444480
tert-butyl 2-[(2S,4S,6S,8R,10S)-10-acetyloxy-4-methyl-2-[(3R)-3-methyl-2-methylidene-4-oxobutyl]-4-triethylsilyloxy-1,7-dioxaspiro[5.5]undecan-8-yl]acetate (PubChem CID 11444480) has the molecular formula C30H52O8Si and a molecular weight of 568.82 g/mol. Its IUPAC name is tert-butyl 2-[(2S,4S,6S,8R,10S)-10-acetyloxy-4-methyl-2-[(3R)-3-methyl-2-methylidene-4-oxobutyl]-4-triethylsilyloxy-1,7-dioxaspiro[5.5]undecan-8-yl]acetate.
| Compound Name | tert-butyl 2-[(2S,4S,6S,8R,10S)-10-acetyloxy-4-methyl-2-[(3R)-3-methyl-2-methylidene-4-oxobutyl]-4-triethylsilyloxy-1,7-dioxaspiro[5.5]undecan-8-yl]acetate |
|---|---|
| PubChem CID | 11444480 |
| Molecular Formula | C30H52O8Si |
| Molecular Weight | 568.82 g/mol |
| Exact Mass | 568.34 |
| IUPAC Name | tert-butyl 2-[(2S,4S,6S,8R,10S)-10-acetyloxy-4-methyl-2-[(3R)-3-methyl-2-methylidene-4-oxobutyl]-4-triethylsilyloxy-1,7-dioxaspiro[5.5]undecan-8-yl]acetate |
| SMILES | C=C(C[C@H]1C[C@](C)(O[Si](CC)(CC)CC)C[C@@]2(C[C@@H](OC(C)=O)C[C@H](CC(=O)OC(C)(C)C)O2)O1)[C@@H](C)C=O |
| InChI | InChI=1S/C30H52O8Si/c1-11-39(12-2,13-3)38-29(10)17-26(14-21(4)22(5)19-31)36-30(20-29)18-25(34-23(6)32)15-24(35-30)16-27(33)37-28(7,8)9/h19,22,24-26H,4,11-18,20H2,1-3,5-10H3/t22-,24+,25-,26-,29-,30+/m0/s1 |
| InChIKey | ISRBHZQCFPLPFW-QKXPXILFSA-N |
| XLogP | 6.27 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.82 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|