C29H56O7Si — CID 10951693
(2R)-2-[(4S,5R,6S)-6-[(2S,5S,6R,7S,8S,9R)-5-[tert-butyl(dimethyl)silyl]oxy-7,9-dihydroxy-6,8-dimethyl-4-methylidenedecan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propanoic acid (PubChem CID 10951693) has the molecular formula C29H56O7Si and a molecular weight of 544.85 g/mol. Its IUPAC name is (2R)-2-[(4S,5R,6S)-6-[(2S,5S,6R,7S,8S,9R)-5-[tert-butyl(dimethyl)silyl]oxy-7,9-dihydroxy-6,8-dimethyl-4-methylidenedecan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propanoic acid.
| Compound Name | (2R)-2-[(4S,5R,6S)-6-[(2S,5S,6R,7S,8S,9R)-5-[tert-butyl(dimethyl)silyl]oxy-7,9-dihydroxy-6,8-dimethyl-4-methylidenedecan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propanoic acid |
|---|---|
| PubChem CID | 10951693 |
| Molecular Formula | C29H56O7Si |
| Molecular Weight | 544.85 g/mol |
| Exact Mass | 544.38 |
| IUPAC Name | (2R)-2-[(4S,5R,6S)-6-[(2S,5S,6R,7S,8S,9R)-5-[tert-butyl(dimethyl)silyl]oxy-7,9-dihydroxy-6,8-dimethyl-4-methylidenedecan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propanoic acid |
| SMILES | C=C(C[C@H](C)[C@@H]1OC(C)(C)O[C@H]([C@@H](C)C(=O)O)[C@@H]1C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](O)[C@@H](C)[C@@H](C)O |
| InChI | InChI=1S/C29H56O7Si/c1-16(24-20(5)26(21(6)27(32)33)35-29(11,12)34-24)15-17(2)25(36-37(13,14)28(8,9)10)19(4)23(31)18(3)22(7)30/h16,18-26,30-31H,2,15H2,1,3-14H3,(H,32,33)/t16-,18-,19+,20+,21+,22+,23-,24-,25+,26-/m0/s1 |
| InChIKey | LHMHCDAHEDAWJJ-APVMWBIGSA-N |
| XLogP | 5.85 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.85 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|