C30H58O7Si2 — CID 10698583
2-[(2S,4S,6S,8R,10S)-10-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-4-methyl-2-[(3R)-3-methyl-2-methylidene-4-triethylsilyloxybutyl]-1,7-dioxaspiro[5.5]undecan-8-yl]acetic acid (PubChem CID 10698583) has the molecular formula C30H58O7Si2 and a molecular weight of 586.96 g/mol. Its IUPAC name is 2-[(2S,4S,6S,8R,10S)-10-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-4-methyl-2-[(3R)-3-methyl-2-methylidene-4-triethylsilyloxybutyl]-1,7-dioxaspiro[5.5]undecan-8-yl]acetic acid.
| Compound Name | 2-[(2S,4S,6S,8R,10S)-10-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-4-methyl-2-[(3R)-3-methyl-2-methylidene-4-triethylsilyloxybutyl]-1,7-dioxaspiro[5.5]undecan-8-yl]acetic acid |
|---|---|
| PubChem CID | 10698583 |
| Molecular Formula | C30H58O7Si2 |
| Molecular Weight | 586.96 g/mol |
| Exact Mass | 586.37 |
| IUPAC Name | 2-[(2S,4S,6S,8R,10S)-10-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-4-methyl-2-[(3R)-3-methyl-2-methylidene-4-triethylsilyloxybutyl]-1,7-dioxaspiro[5.5]undecan-8-yl]acetic acid |
| SMILES | C=C(C[C@H]1C[C@](C)(O)C[C@@]2(C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](CC(=O)O)O2)O1)[C@@H](C)CO[Si](CC)(CC)CC |
| InChI | InChI=1S/C30H58O7Si2/c1-12-39(13-2,14-3)34-20-23(5)22(4)15-25-18-29(9,33)21-30(36-25)19-26(16-24(35-30)17-27(31)32)37-38(10,11)28(6,7)8/h23-26,33H,4,12-21H2,1-3,5-11H3,(H,31,32)/t23-,24+,25-,26-,29-,30+/m0/s1 |
| InChIKey | SJTKECDTZCKXNE-DNJRULNNSA-N |
| XLogP | 7.26 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.96 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|