C27H52O8Si — CID 10506442
tert-butyl 2-[(2S,4S,6S,8R,10S)-10-[tert-butyl(dimethyl)silyl]oxy-2-[(2S,3S)-2,4-dihydroxy-3-methylbutyl]-4-hydroxy-4-methyl-1,7-dioxaspiro[5.5]undecan-8-yl]acetate (PubChem CID 10506442) has the molecular formula C27H52O8Si and a molecular weight of 532.79 g/mol. Its IUPAC name is tert-butyl 2-[(2S,4S,6S,8R,10S)-10-[tert-butyl(dimethyl)silyl]oxy-2-[(2S,3S)-2,4-dihydroxy-3-methylbutyl]-4-hydroxy-4-methyl-1,7-dioxaspiro[5.5]undecan-8-yl]acetate.
| Compound Name | tert-butyl 2-[(2S,4S,6S,8R,10S)-10-[tert-butyl(dimethyl)silyl]oxy-2-[(2S,3S)-2,4-dihydroxy-3-methylbutyl]-4-hydroxy-4-methyl-1,7-dioxaspiro[5.5]undecan-8-yl]acetate |
|---|---|
| PubChem CID | 10506442 |
| Molecular Formula | C27H52O8Si |
| Molecular Weight | 532.79 g/mol |
| Exact Mass | 532.34 |
| IUPAC Name | tert-butyl 2-[(2S,4S,6S,8R,10S)-10-[tert-butyl(dimethyl)silyl]oxy-2-[(2S,3S)-2,4-dihydroxy-3-methylbutyl]-4-hydroxy-4-methyl-1,7-dioxaspiro[5.5]undecan-8-yl]acetate |
| SMILES | C[C@@H](CO)[C@@H](O)C[C@H]1C[C@](C)(O)C[C@@]2(C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](CC(=O)OC(C)(C)C)O2)O1 |
| InChI | InChI=1S/C27H52O8Si/c1-18(16-28)22(29)12-20-14-26(8,31)17-27(33-20)15-21(35-36(9,10)25(5,6)7)11-19(32-27)13-23(30)34-24(2,3)4/h18-22,28-29,31H,11-17H2,1-10H3/t18-,19+,20-,21-,22-,26-,27+/m0/s1 |
| InChIKey | YQQHFQJWJPBZMU-LDKLXIKSSA-N |
| XLogP | 4.29 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.79 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|