C24H46O7Si — CID 10743155
tert-butyl 2-[(2S,4S,6S,8R,10S)-10-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-2-(2-hydroxyethyl)-4-methyl-1,7-dioxaspiro[5.5]undecan-8-yl]acetate (PubChem CID 10743155) has the molecular formula C24H46O7Si and a molecular weight of 474.71 g/mol. Its IUPAC name is tert-butyl 2-[(2S,4S,6S,8R,10S)-10-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-2-(2-hydroxyethyl)-4-methyl-1,7-dioxaspiro[5.5]undecan-8-yl]acetate.
| Compound Name | tert-butyl 2-[(2S,4S,6S,8R,10S)-10-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-2-(2-hydroxyethyl)-4-methyl-1,7-dioxaspiro[5.5]undecan-8-yl]acetate |
|---|---|
| PubChem CID | 10743155 |
| Molecular Formula | C24H46O7Si |
| Molecular Weight | 474.71 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | tert-butyl 2-[(2S,4S,6S,8R,10S)-10-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-2-(2-hydroxyethyl)-4-methyl-1,7-dioxaspiro[5.5]undecan-8-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@@]2(C[C@@](C)(O)C[C@H](CCO)O2)O1 |
| InChI | InChI=1S/C24H46O7Si/c1-21(2,3)30-20(26)13-18-12-19(31-32(8,9)22(4,5)6)15-24(29-18)16-23(7,27)14-17(28-24)10-11-25/h17-19,25,27H,10-16H2,1-9H3/t17-,18+,19-,23-,24-/m0/s1 |
| InChIKey | OVKRAQGVGOZXRD-RNWLQCGYSA-N |
| XLogP | 4.30 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.71 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|