C17H26N2O — CID 114466151
2-(aminomethyl)-N-[2-(2-methylprop-2-enoxy)ethyl]-3,4-dihydro-1H-naphthalen-2-amine (PubChem CID 114466151) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[2-(2-methylprop-2-enoxy)ethyl]-3,4-dihydro-1H-naphthalen-2-amine.
| Compound Name | 2-(aminomethyl)-N-[2-(2-methylprop-2-enoxy)ethyl]-3,4-dihydro-1H-naphthalen-2-amine |
|---|---|
| PubChem CID | 114466151 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 2-(aminomethyl)-N-[2-(2-methylprop-2-enoxy)ethyl]-3,4-dihydro-1H-naphthalen-2-amine |
| SMILES | C=C(C)COCCNC1(CN)CCc2ccccc2C1 |
| InChI | InChI=1S/C17H26N2O/c1-14(2)12-20-10-9-19-17(13-18)8-7-15-5-3-4-6-16(15)11-17/h3-6,19H,1,7-13,18H2,2H3 |
| InChIKey | BWJVJQBYRUPGHO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|