C14H18O2S — CID 11448088
(5S,7S)-7-phenyl-1-oxa-4-thiaspiro[4.5]decan-7-ol (PubChem CID 11448088) has the molecular formula C14H18O2S and a molecular weight of 250.36 g/mol. Its IUPAC name is (5S,7S)-7-phenyl-1-oxa-4-thiaspiro[4.5]decan-7-ol.
| Compound Name | (5S,7S)-7-phenyl-1-oxa-4-thiaspiro[4.5]decan-7-ol |
|---|---|
| PubChem CID | 11448088 |
| Molecular Formula | C14H18O2S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (5S,7S)-7-phenyl-1-oxa-4-thiaspiro[4.5]decan-7-ol |
| SMILES | O[C@@]1(c2ccccc2)CCC[C@]2(C1)OCCS2 |
| InChI | InChI=1S/C14H18O2S/c15-13(12-5-2-1-3-6-12)7-4-8-14(11-13)16-9-10-17-14/h1-3,5-6,15H,4,7-11H2/t13-,14-/m0/s1 |
| InChIKey | NFKQXEGNRHMIFM-KBPBESRZSA-N |
| XLogP | 2.91 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |