C16H26O6 — CID 11449843
(4S,5S,6R)-4-[(Z)-2-ethoxyethenyl]-5-methoxy-6-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]oxan-2-one (PubChem CID 11449843) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is (4S,5S,6R)-4-[(Z)-2-ethoxyethenyl]-5-methoxy-6-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]oxan-2-one.
| Compound Name | (4S,5S,6R)-4-[(Z)-2-ethoxyethenyl]-5-methoxy-6-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]oxan-2-one |
|---|---|
| PubChem CID | 11449843 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (4S,5S,6R)-4-[(Z)-2-ethoxyethenyl]-5-methoxy-6-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]oxan-2-one |
| SMILES | CCO/C=C\[C@@H]1CC(=O)O[C@@H]([C@H]2OC(C)(C)O[C@@H]2C)[C@H]1OC |
| InChI | InChI=1S/C16H26O6/c1-6-19-8-7-11-9-12(17)20-15(14(11)18-5)13-10(2)21-16(3,4)22-13/h7-8,10-11,13-15H,6,9H2,1-5H3/b8-7-/t10-,11-,13+,14+,15+/m1/s1 |
| InChIKey | ZVAFAOHGZPDLPK-MQMSOSBFSA-N |
| XLogP | 2.02 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|