C14H17N5O — CID 114523399
(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)-(5-ethyl-1H-1,2,4-triazol-3-yl)methanone (PubChem CID 114523399) has the molecular formula C14H17N5O and a molecular weight of 271.32 g/mol. Its IUPAC name is (8-amino-3,4-dihydro-1H-isoquinolin-2-yl)-(5-ethyl-1H-1,2,4-triazol-3-yl)methanone.
| Compound Name | (8-amino-3,4-dihydro-1H-isoquinolin-2-yl)-(5-ethyl-1H-1,2,4-triazol-3-yl)methanone |
|---|---|
| PubChem CID | 114523399 |
| Molecular Formula | C14H17N5O |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | (8-amino-3,4-dihydro-1H-isoquinolin-2-yl)-(5-ethyl-1H-1,2,4-triazol-3-yl)methanone |
| SMILES | CCc1nc(C(=O)N2CCc3cccc(N)c3C2)n[nH]1 |
| InChI | InChI=1S/C14H17N5O/c1-2-12-16-13(18-17-12)14(20)19-7-6-9-4-3-5-11(15)10(9)8-19/h3-5H,2,6-8,15H2,1H3,(H,16,17,18) |
| InChIKey | USYQCNIIMKQMGX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|