C23H30Cl2O5 — CID 11453879
2-[[(1'R,2'S,4'aR,8'aS)-1',2',4'a-trimethylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydro-2H-naphthalene]-1'-yl]methyl]-5,6-dichloro-3-methoxycyclohexa-2,5-diene-1,4-dione (PubChem CID 11453879) has the molecular formula C23H30Cl2O5 and a molecular weight of 457.39 g/mol. Its IUPAC name is 2-[[(1'R,2'S,4'aR,8'aS)-1',2',4'a-trimethylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydro-2H-naphthalene]-1'-yl]methyl]-5,6-dichloro-3-methoxycyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[[(1'R,2'S,4'aR,8'aS)-1',2',4'a-trimethylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydro-2H-naphthalene]-1'-yl]methyl]-5,6-dichloro-3-methoxycyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 11453879 |
| Molecular Formula | C23H30Cl2O5 |
| Molecular Weight | 457.39 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 2-[[(1'R,2'S,4'aR,8'aS)-1',2',4'a-trimethylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydro-2H-naphthalene]-1'-yl]methyl]-5,6-dichloro-3-methoxycyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=C(C[C@]2(C)[C@@H](C)CC[C@]3(C)[C@H]2CCCC32OCCO2)C(=O)C(Cl)=C(Cl)C1=O |
| InChI | InChI=1S/C23H30Cl2O5/c1-13-7-9-22(3)15(6-5-8-23(22)29-10-11-30-23)21(13,2)12-14-18(26)16(24)17(25)19(27)20(14)28-4/h13,15H,5-12H2,1-4H3/t13-,15-,21+,22+/m0/s1 |
| InChIKey | OJSOIXNREAWFNM-QEBWYSDHSA-N |
| XLogP | 5.10 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.39 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|