C22H28Cl2O5 — CID 102376425
2-[(1'R,2'S,4'aR,8'aS)-1',2',4'a-trimethylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydro-2H-naphthalene]-1'-yl]-5,6-dichloro-3-methoxycyclohexa-2,5-diene-1,4-dione (PubChem CID 102376425) has the molecular formula C22H28Cl2O5 and a molecular weight of 443.37 g/mol. Its IUPAC name is 2-[(1'R,2'S,4'aR,8'aS)-1',2',4'a-trimethylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydro-2H-naphthalene]-1'-yl]-5,6-dichloro-3-methoxycyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[(1'R,2'S,4'aR,8'aS)-1',2',4'a-trimethylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydro-2H-naphthalene]-1'-yl]-5,6-dichloro-3-methoxycyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 102376425 |
| Molecular Formula | C22H28Cl2O5 |
| Molecular Weight | 443.37 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 2-[(1'R,2'S,4'aR,8'aS)-1',2',4'a-trimethylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydro-2H-naphthalene]-1'-yl]-5,6-dichloro-3-methoxycyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=C([C@]2(C)[C@@H](C)CC[C@]3(C)[C@H]2CCCC32OCCO2)C(=O)C(Cl)=C(Cl)C1=O |
| InChI | InChI=1S/C22H28Cl2O5/c1-12-7-9-20(2)13(6-5-8-22(20)28-10-11-29-22)21(12,3)14-17(25)15(23)16(24)18(26)19(14)27-4/h12-13H,5-11H2,1-4H3/t12-,13+,20+,21+/m0/s1 |
| InChIKey | AHOSEZVEIKASOG-GQSHPZAJSA-N |
| XLogP | 4.71 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.37 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|