C26H41IO2Se — CID 11456100
2-[(E)-6-iodo-6-[2,4,6-tri(propan-2-yl)phenyl]selanylhex-5-enoxy]oxane (PubChem CID 11456100) has the molecular formula C26H41IO2Se and a molecular weight of 591.48 g/mol. Its IUPAC name is 2-[(E)-6-iodo-6-[2,4,6-tri(propan-2-yl)phenyl]selanylhex-5-enoxy]oxane.
| Compound Name | 2-[(E)-6-iodo-6-[2,4,6-tri(propan-2-yl)phenyl]selanylhex-5-enoxy]oxane |
|---|---|
| PubChem CID | 11456100 |
| Molecular Formula | C26H41IO2Se |
| Molecular Weight | 591.48 g/mol |
| Exact Mass | 592.13 |
| IUPAC Name | 2-[(E)-6-iodo-6-[2,4,6-tri(propan-2-yl)phenyl]selanylhex-5-enoxy]oxane |
| SMILES | CC(C)c1cc(C(C)C)c([Se]/C(I)=C\CCCCOC2CCCCO2)c(C(C)C)c1 |
| InChI | InChI=1S/C26H41IO2Se/c1-18(2)21-16-22(19(3)4)26(23(17-21)20(5)6)30-24(27)12-8-7-10-14-28-25-13-9-11-15-29-25/h12,16-20,25H,7-11,13-15H2,1-6H3/b24-12- |
| InChIKey | ZRZKFADSCGPXQD-MSXFZWOLSA-N |
| XLogP | 7.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.48 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|