C13H12N4OS2 — CID 114585533
4-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-2-ethyl-1H-pyrimidin-6-one (PubChem CID 114585533) has the molecular formula C13H12N4OS2 and a molecular weight of 304.40 g/mol. Its IUPAC name is 4-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-2-ethyl-1H-pyrimidin-6-one.
| Compound Name | 4-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-2-ethyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114585533 |
| Molecular Formula | C13H12N4OS2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 4-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-2-ethyl-1H-pyrimidin-6-one |
| SMILES | CCc1nc(Sc2nc3ccc(N)cc3s2)cc(=O)[nH]1 |
| InChI | InChI=1S/C13H12N4OS2/c1-2-10-16-11(18)6-12(17-10)20-13-15-8-4-3-7(14)5-9(8)19-13/h3-6H,2,14H2,1H3,(H,16,17,18) |
| InChIKey | OXOLTIHGDNLVIW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|