C14H14N4OS2 — CID 62929034
3-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-1-propylpyrazin-2-one (PubChem CID 62929034) has the molecular formula C14H14N4OS2 and a molecular weight of 318.43 g/mol. Its IUPAC name is 3-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-1-propylpyrazin-2-one.
| Compound Name | 3-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-1-propylpyrazin-2-one |
|---|---|
| PubChem CID | 62929034 |
| Molecular Formula | C14H14N4OS2 |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 3-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-1-propylpyrazin-2-one |
| SMILES | CCCn1ccnc(Sc2nc3ccc(N)cc3s2)c1=O |
| InChI | InChI=1S/C14H14N4OS2/c1-2-6-18-7-5-16-12(13(18)19)21-14-17-10-4-3-9(15)8-11(10)20-14/h3-5,7-8H,2,6,15H2,1H3 |
| InChIKey | XJXWGUUCCNLVHL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|