C15H12O5 — CID 11459957
2-(2,6-dioxocyclohexyl)-2-hydroxyindene-1,3-dione (PubChem CID 11459957) has the molecular formula C15H12O5 and a molecular weight of 272.26 g/mol. Its IUPAC name is 2-(2,6-dioxocyclohexyl)-2-hydroxyindene-1,3-dione.
| Compound Name | 2-(2,6-dioxocyclohexyl)-2-hydroxyindene-1,3-dione |
|---|---|
| PubChem CID | 11459957 |
| Molecular Formula | C15H12O5 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 2-(2,6-dioxocyclohexyl)-2-hydroxyindene-1,3-dione |
| SMILES | O=C1CCCC(=O)C1C1(O)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H12O5/c16-10-6-3-7-11(17)12(10)15(20)13(18)8-4-1-2-5-9(8)14(15)19/h1-2,4-5,12,20H,3,6-7H2 |
| InChIKey | APCIXXHBJXRKFI-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|