C18H19N — CID 114605983
1-(3-cyclobutylphenyl)-2,3-dihydro-1H-isoindole (PubChem CID 114605983) has the molecular formula C18H19N and a molecular weight of 249.36 g/mol. Its IUPAC name is 1-(3-cyclobutylphenyl)-2,3-dihydro-1H-isoindole.
| Compound Name | 1-(3-cyclobutylphenyl)-2,3-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 114605983 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 1-(3-cyclobutylphenyl)-2,3-dihydro-1H-isoindole |
| SMILES | c1cc(C2CCC2)cc(C2NCc3ccccc32)c1 |
| InChI | InChI=1S/C18H19N/c1-2-10-17-16(5-1)12-19-18(17)15-9-4-8-14(11-15)13-6-3-7-13/h1-2,4-5,8-11,13,18-19H,3,6-7,12H2 |
| InChIKey | IRAFPUFEVRKLEM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |