C13H25N5OS — CID 114624131
N-ethyl-2-[5-(2,2,5,5-tetramethyloxolan-3-yl)sulfanyltetrazol-1-yl]ethanamine (PubChem CID 114624131) has the molecular formula C13H25N5OS and a molecular weight of 299.44 g/mol. Its IUPAC name is N-ethyl-2-[5-(2,2,5,5-tetramethyloxolan-3-yl)sulfanyltetrazol-1-yl]ethanamine.
| Compound Name | N-ethyl-2-[5-(2,2,5,5-tetramethyloxolan-3-yl)sulfanyltetrazol-1-yl]ethanamine |
|---|---|
| PubChem CID | 114624131 |
| Molecular Formula | C13H25N5OS |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | N-ethyl-2-[5-(2,2,5,5-tetramethyloxolan-3-yl)sulfanyltetrazol-1-yl]ethanamine |
| SMILES | CCNCCn1nnnc1SC1CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C13H25N5OS/c1-6-14-7-8-18-11(15-16-17-18)20-10-9-12(2,3)19-13(10,4)5/h10,14H,6-9H2,1-5H3 |
| InChIKey | LQPJKTFOIWQOLQ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|