C17H24N2O — CID 114624168
[1-(2,2,5,5-tetramethyloxolan-3-yl)indol-7-yl]methanamine (PubChem CID 114624168) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is [1-(2,2,5,5-tetramethyloxolan-3-yl)indol-7-yl]methanamine.
| Compound Name | [1-(2,2,5,5-tetramethyloxolan-3-yl)indol-7-yl]methanamine |
|---|---|
| PubChem CID | 114624168 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | [1-(2,2,5,5-tetramethyloxolan-3-yl)indol-7-yl]methanamine |
| SMILES | CC1(C)CC(n2ccc3cccc(CN)c32)C(C)(C)O1 |
| InChI | InChI=1S/C17H24N2O/c1-16(2)10-14(17(3,4)20-16)19-9-8-12-6-5-7-13(11-18)15(12)19/h5-9,14H,10-11,18H2,1-4H3 |
| InChIKey | VUEYDOHKQMNLKP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |