C12H12ClFN2O3S2 — CID 114625759
3-amino-N-[(5-chlorothiophen-2-yl)methyl]-5-fluoro-4-methoxybenzenesulfonamide (PubChem CID 114625759) has the molecular formula C12H12ClFN2O3S2 and a molecular weight of 350.82 g/mol. Its IUPAC name is 3-amino-N-[(5-chlorothiophen-2-yl)methyl]-5-fluoro-4-methoxybenzenesulfonamide.
| Compound Name | 3-amino-N-[(5-chlorothiophen-2-yl)methyl]-5-fluoro-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 114625759 |
| Molecular Formula | C12H12ClFN2O3S2 |
| Molecular Weight | 350.82 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 3-amino-N-[(5-chlorothiophen-2-yl)methyl]-5-fluoro-4-methoxybenzenesulfonamide |
| SMILES | COc1c(N)cc(S(=O)(=O)NCc2ccc(Cl)s2)cc1F |
| InChI | InChI=1S/C12H12ClFN2O3S2/c1-19-12-9(14)4-8(5-10(12)15)21(17,18)16-6-7-2-3-11(13)20-7/h2-5,16H,6,15H2,1H3 |
| InChIKey | QXJFXWSPUAQWKB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.82 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|