C21H28O4S — CID 11463033
(2S,4R)-5-methyl-1-(4-methylphenyl)sulfonyl-4-phenylmethoxyhexan-2-ol (PubChem CID 11463033) has the molecular formula C21H28O4S and a molecular weight of 376.52 g/mol. Its IUPAC name is (2S,4R)-5-methyl-1-(4-methylphenyl)sulfonyl-4-phenylmethoxyhexan-2-ol.
| Compound Name | (2S,4R)-5-methyl-1-(4-methylphenyl)sulfonyl-4-phenylmethoxyhexan-2-ol |
|---|---|
| PubChem CID | 11463033 |
| Molecular Formula | C21H28O4S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | (2S,4R)-5-methyl-1-(4-methylphenyl)sulfonyl-4-phenylmethoxyhexan-2-ol |
| SMILES | Cc1ccc(S(=O)(=O)C[C@@H](O)C[C@@H](OCc2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C21H28O4S/c1-16(2)21(25-14-18-7-5-4-6-8-18)13-19(22)15-26(23,24)20-11-9-17(3)10-12-20/h4-12,16,19,21-22H,13-15H2,1-3H3/t19-,21+/m0/s1 |
| InChIKey | LOOPEKNVODSWKW-PZJWPPBQSA-N |
| XLogP | 3.76 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |