About 2-ethoxy-3,3-dimethyl-1-(3-methyltriazol-4-yl)butan-1-ol
2-ethoxy-3,3-dimethyl-1-(3-methyltriazol-4-yl)butan-1-ol (PubChem CID 114686804) has the molecular formula C11H21N3O2
and a molecular weight of 227.31 g/mol. Its IUPAC name is 2-ethoxy-3,3-dimethyl-1-(3-methyltriazol-4-yl)butan-1-ol.
Molecular Properties
| Compound Name | 2-ethoxy-3,3-dimethyl-1-(3-methyltriazol-4-yl)butan-1-ol |
| PubChem CID | 114686804 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | 2-ethoxy-3,3-dimethyl-1-(3-methyltriazol-4-yl)butan-1-ol |
| SMILES | CCOC(C(O)c1cnnn1C)C(C)(C)C |
| InChI | InChI=1S/C11H21N3O2/c1-6-16-10(11(2,3)4)9(15)8-7-12-13-14(8)5/h7,9-10,15H,6H2,1-5H3 |
| InChIKey | UIQDNRSKWYCKFJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-ethoxy-3,3-dimethyl-1-(3-methyltriazol-4-yl)butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-3,3-dimethyl-1-(3-methyltriazol-4-yl)butan-1-ol?
The IUPAC name of 2-ethoxy-3,3-dimethyl-1-(3-methyltriazol-4-yl)butan-1-ol (CID 114686804) is 2-ethoxy-3,3-dimethyl-1-(3-methyltriazol-4-yl)butan-1-ol.
What is the SMILES notation for 2-ethoxy-3,3-dimethyl-1-(3-methyltriazol-4-yl)butan-1-ol?
The canonical SMILES for 2-ethoxy-3,3-dimethyl-1-(3-methyltriazol-4-yl)butan-1-ol is CCOC(C(O)c1cnnn1C)C(C)(C)C.
What is the InChIKey of 2-ethoxy-3,3-dimethyl-1-(3-methyltriazol-4-yl)butan-1-ol?
The InChIKey is UIQDNRSKWYCKFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O2/c1-6-16-10(11(2,3)4)9(15)8-7-12-13-14(8)5/h7,9-10,15H,6H2,1-5H3.
What are the key properties of 2-ethoxy-3,3-dimethyl-1-(3-methyltriazol-4-yl)butan-1-ol?
2-ethoxy-3,3-dimethyl-1-(3-methyltriazol-4-yl)butan-1-ol has a molecular weight of 227.31 g/mol, XLogP of 1.30, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-3,3-dimethyl-1-(3-methyltriazol-4-yl)butan-1-ol is sourced from PubChem (CID 114686804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).