C11H21N3O2 — CID 114686804
2-ethoxy-3,3-dimethyl-1-(3-methyltriazol-4-yl)butan-1-ol (PubChem CID 114686804) has the molecular formula C11H21N3O2 and a molecular weight of 227.31 g/mol. Its IUPAC name is 2-ethoxy-3,3-dimethyl-1-(3-methyltriazol-4-yl)butan-1-ol.
| Compound Name | 2-ethoxy-3,3-dimethyl-1-(3-methyltriazol-4-yl)butan-1-ol |
|---|---|
| PubChem CID | 114686804 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | 2-ethoxy-3,3-dimethyl-1-(3-methyltriazol-4-yl)butan-1-ol |
| SMILES | CCOC(C(O)c1cnnn1C)C(C)(C)C |
| InChI | InChI=1S/C11H21N3O2/c1-6-16-10(11(2,3)4)9(15)8-7-12-13-14(8)5/h7,9-10,15H,6H2,1-5H3 |
| InChIKey | UIQDNRSKWYCKFJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |