C10H14O2 — CID 11469283
(1R,2R,6R)-1,6-bis(ethenyl)-7-oxabicyclo[4.1.0]heptan-2-ol (PubChem CID 11469283) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (1R,2R,6R)-1,6-bis(ethenyl)-7-oxabicyclo[4.1.0]heptan-2-ol.
| Compound Name | (1R,2R,6R)-1,6-bis(ethenyl)-7-oxabicyclo[4.1.0]heptan-2-ol |
|---|---|
| PubChem CID | 11469283 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (1R,2R,6R)-1,6-bis(ethenyl)-7-oxabicyclo[4.1.0]heptan-2-ol |
| SMILES | C=C[C@]12CCC[C@@H](O)[C@@]1(C=C)O2 |
| InChI | InChI=1S/C10H14O2/c1-3-9-7-5-6-8(11)10(9,4-2)12-9/h3-4,8,11H,1-2,5-7H2/t8-,9+,10-/m1/s1 |
| InChIKey | SLLYXAIKRORKKS-KXUCPTDWSA-N |
| XLogP | 1.41 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|